https://github.com/RayanC94/App_Twale
· scanned 2026-06-15 23:47 UTC (2 months, 3 weeks ago)
24 raw signals (0 security + 24 graph)
Last scanned 2 months, 3 weeks ago · v1 · 24 actionable findings from 1 signal source. Security checks, system graph analysis, and verified AI-agent feedback are merged into one review queue.
All 452 nodes from the latest scan, grouped by kind. Each node is a unit the engine identified (file, function, endpoint, table…). Most users won't need this view — it's primarily for debugging the engine's graph extraction or for AI agents that want to enumerate the project structure.
| Label | Layer | Status | Path |
|---|---|---|---|
middleware |
software | healthy | middleware.ts:middleware |
die |
software | healthy | scripts/seed-volley-finale.mjs:die |
notFinished |
software | healthy | scripts/seed-volley-finale.mjs:notFinished |
rank |
software | healthy | scripts/seed-volley-finale.mjs:rank |
kickoff |
software | healthy | scripts/seed-volley-finale.mjs:kickoff |
fld |
software | healthy | scripts/seed-volley-finale.mjs:fld |
sorted |
software | healthy | scripts/seed-volley-finale.mjs:sorted |
h |
software | healthy | scripts/seed-volley-finale.mjs:h |
a |
software | healthy | scripts/seed-volley-finale.mjs:a |
kickoff |
software | healthy | scripts/seed-volley-tournoi.mjs:kickoff |
die |
software | healthy | scripts/seed-volley-tournoi.mjs:die |
oldPoolIds |
software | healthy | scripts/seed-volley-tournoi.mjs:oldPoolIds |
obsolete |
software | healthy | scripts/seed-volley-tournoi.mjs:obsolete |
nBad |
software | healthy | scripts/seed-volley-tournoi.mjs:nBad |
group |
software | healthy | scripts/read-standings.mjs:group |
tieKey |
software | healthy | scripts/read-standings.mjs:tieKey |
bracket |
software | healthy | scripts/read-standings.mjs:bracket |
terrainName |
software | healthy | scripts/seed-foot-tournoi.mjs:terrainName |
kickoff |
software | healthy | scripts/seed-foot-tournoi.mjs:kickoff |
die |
software | healthy | scripts/seed-foot-tournoi.mjs:die |
oldPoolIds |
software | healthy | scripts/seed-foot-tournoi.mjs:oldPoolIds |
obsolete |
software | healthy | scripts/seed-foot-tournoi.mjs:obsolete |
nBad |
software | healthy | scripts/seed-foot-tournoi.mjs:nBad |
ok |
software | healthy | scripts/seed-db.mjs:ok |
fail |
software | healthy | scripts/seed-db.mjs:fail |
die |
software | healthy | scripts/seed-foot-finale.mjs:die |
notFinished |
software | healthy | scripts/seed-foot-finale.mjs:notFinished |
rank |
software | healthy | scripts/seed-foot-finale.mjs:rank |
kickoff |
software | healthy | scripts/seed-foot-finale.mjs:kickoff |
fld |
software | healthy | scripts/seed-foot-finale.mjs:fld |
sorted |
software | healthy | scripts/seed-foot-finale.mjs:sorted |
h |
software | healthy | scripts/seed-foot-finale.mjs:h |
a |
software | healthy | scripts/seed-foot-finale.mjs:a |
BottomNav |
software | healthy | src/components/public/BottomNav.tsx:BottomNav |
ComingSoon |
software | healthy | src/components/public/ComingSoon.tsx:ComingSoon |
formatHour |
software | healthy | src/components/public/MatchCard.tsx:formatHour |
labelOf |
software | healthy | src/components/public/MatchCard.tsx:labelOf |
MatchCard |
software | healthy | src/components/public/MatchCard.tsx:MatchCard |
scrollToTop |
software | healthy | src/components/public/BuccoQuizForm.tsx:scrollToTop |
BuccoQuizForm |
software | healthy | src/components/public/BuccoQuizForm.tsx:BuccoQuizForm |
setSingle |
software | healthy | src/components/public/BuccoQuizForm.tsx:setSingle |
toggleMulti |
software | healthy | src/components/public/BuccoQuizForm.tsx:toggleMulti |
setMatch |
software | healthy | src/components/public/BuccoQuizForm.tsx:setMatch |
cur |
software | healthy | src/components/public/BuccoQuizForm.tsx:cur |
setText |
software | healthy | src/components/public/BuccoQuizForm.tsx:setText |
handleSubmit |
software | healthy | src/components/public/BuccoQuizForm.tsx:handleSubmit |
QuestionCard |
software | healthy | src/components/public/BuccoQuizForm.tsx:QuestionCard |
QuestionInputs |
software | healthy | src/components/public/BuccoQuizForm.tsx:QuestionInputs |
current |
software | healthy | src/components/public/BuccoQuizForm.tsx:current |
BuccoResult |
software | healthy | src/components/public/BuccoQuizForm.tsx:BuccoResult |
Showing first 50 of this kind. Full payload available via the JSON button at the top of the page.
| Label | Layer | Status | Path |
|---|---|---|---|
.mcp.json |
software | healthy | .mcp.json |
postcss.config.mjs |
software | healthy | postcss.config.mjs |
README.md |
software | healthy | README.md |
CLAUDE.md |
software | healthy | CLAUDE.md |
package.json |
software | healthy | package.json |
package-lock.json |
software | healthy | package-lock.json |
middleware.ts |
software | healthy | middleware.ts |
tsconfig.json |
software | healthy | tsconfig.json |
eslint.config.mjs |
software | healthy | eslint.config.mjs |
AGENTS.md |
software | healthy | AGENTS.md |
next.config.ts |
software | healthy | next.config.ts |
google-forms-supabase.md |
software | healthy | docs/google-forms-supabase.md |
seed-volley-finale.mjs |
software | healthy | scripts/seed-volley-finale.mjs |
seed-admin.mjs |
software | healthy | scripts/seed-admin.mjs |
seed-volley-tournoi.mjs |
software | healthy | scripts/seed-volley-tournoi.mjs |
read-standings.mjs |
software | healthy | scripts/read-standings.mjs |
seed-foot-tournoi.mjs |
software | healthy | scripts/seed-foot-tournoi.mjs |
check-db.mjs |
software | healthy | scripts/check-db.mjs |
seed-db.mjs |
software | healthy | scripts/seed-db.mjs |
seed-foot-finale.mjs |
software | healthy | scripts/seed-foot-finale.mjs |
seed-teams.mjs |
software | healthy | scripts/seed-teams.mjs |
seed.sql |
software | healthy | supabase/seed.sql |
apply-me.sql |
software | healthy | supabase/apply-me.sql |
2026-06-13-quiz-village.sql |
software | healthy | supabase/2026-06-13-quiz-village.sql |
2026-06-13-form-responses.sql |
software | healthy | supabase/2026-06-13-form-responses.sql |
2026-06-12-sondage-partenaires.sql |
software | healthy | supabase/2026-06-12-sondage-partenaires.sql |
0001_init.sql |
software | healthy | supabase/migrations/0001_init.sql |
BottomNav.tsx |
software | healthy | src/components/public/BottomNav.tsx |
ComingSoon.tsx |
software | healthy | src/components/public/ComingSoon.tsx |
MatchCard.tsx |
software | healthy | src/components/public/MatchCard.tsx |
BuccoQuizForm.tsx |
software | healthy | src/components/public/BuccoQuizForm.tsx |
LiveVideo.tsx |
software | healthy | src/components/public/LiveVideo.tsx |
EcransTestForm.tsx |
software | healthy | src/components/public/EcransTestForm.tsx |
LiveScore.tsx |
software | healthy | src/components/public/LiveScore.tsx |
PoolStandings.tsx |
software | healthy | src/components/public/PoolStandings.tsx |
Lightbox.tsx |
software | healthy | src/components/public/Lightbox.tsx |
RealtimeRefresh.tsx |
software | healthy | src/components/public/RealtimeRefresh.tsx |
SiteMap.tsx |
software | healthy | src/components/public/SiteMap.tsx |
LiveStreamBanner.tsx |
software | healthy | src/components/public/LiveStreamBanner.tsx |
globals.css |
software | healthy | src/app/globals.css |
layout.tsx |
software | healthy | src/app/layout.tsx |
route.ts |
software | healthy | src/app/api/healthcheck/route.ts |
AdminNav.tsx |
software | healthy | src/app/admin/AdminNav.tsx |
PinForm.tsx |
software | healthy | src/app/admin/login/PinForm.tsx |
page.tsx |
software | healthy | src/app/admin/login/page.tsx |
_AdminStub.tsx |
software | healthy | src/app/admin/(protected)/_AdminStub.tsx |
loading.tsx |
software | healthy | src/app/admin/(protected)/loading.tsx |
page.tsx |
software | healthy | src/app/admin/(protected)/page.tsx |
layout.tsx |
software | healthy | src/app/admin/(protected)/layout.tsx |
LiveLinksForm.tsx |
software | healthy | src/app/admin/(protected)/live/LiveLinksForm.tsx |
Showing first 50 of this kind. Full payload available via the JSON button at the top of the page.
| Label | Layer | Status | Path |
|---|---|---|---|
docs |
software | healthy | docs |
scripts |
software | healthy | scripts |
supabase |
software | healthy | supabase |
migrations |
software | healthy | supabase/migrations |
src |
software | healthy | src |
components |
software | healthy | src/components |
public |
software | healthy | src/components/public |
app |
software | healthy | src/app |
api |
software | healthy | src/app/api |
healthcheck |
software | healthy | src/app/api/healthcheck |
admin |
software | healthy | src/app/admin |
login |
software | healthy | src/app/admin/login |
(protected) |
software | healthy | src/app/admin/(protected) |
live |
software | healthy | src/app/admin/(protected)/live |
equipes |
software | healthy | src/app/admin/(protected)/equipes |
sondage |
software | healthy | src/app/admin/(protected)/sondage |
athle |
software | healthy | src/app/admin/(protected)/athle |
matchs |
software | healthy | src/app/admin/(protected)/matchs |
(public) |
software | healthy | src/app/(public) |
carte |
software | healthy | src/app/(public)/carte |
live |
software | healthy | src/app/(public)/live |
galerie |
software | healthy | src/app/(public)/galerie |
sante |
software | healthy | src/app/(public)/sante |
[slug] |
software | healthy | src/app/(public)/sante/[slug] |
quiz |
software | healthy | src/app/(public)/sante/[slug]/quiz |
sponsors |
software | healthy | src/app/(public)/sponsors |
sondage |
software | healthy | src/app/(public)/sondage |
food |
software | healthy | src/app/(public)/food |
planning |
software | healthy | src/app/(public)/planning |
tournoi |
software | healthy | src/app/(public)/tournoi |
match |
software | healthy | src/app/(public)/tournoi/match |
[id] |
software | healthy | src/app/(public)/tournoi/match/[id] |
foot |
software | healthy | src/app/(public)/tournoi/foot |
athle |
software | healthy | src/app/(public)/tournoi/athle |
equipe |
software | healthy | src/app/(public)/tournoi/equipe |
[id] |
software | healthy | src/app/(public)/tournoi/equipe/[id] |
volley |
software | healthy | src/app/(public)/tournoi/volley |
lib |
software | healthy | src/lib |
auth |
software | healthy | src/lib/auth |
supabase |
software | healthy | src/lib/supabase |
actions |
software | healthy | src/actions |
| Label | Layer | Status | Path |
|---|---|---|---|
/admin/login |
frontend | healthy | src/app/admin/login/page.tsx |
/admin/(protected) |
frontend | healthy | src/app/admin/(protected)/page.tsx |
/admin/(protected)/live |
frontend | healthy | src/app/admin/(protected)/live/page.tsx |
/admin/(protected)/equipes |
frontend | healthy | src/app/admin/(protected)/equipes/page.tsx |
/admin/(protected)/sondage |
frontend | healthy | src/app/admin/(protected)/sondage/page.tsx |
/admin/(protected)/athle |
frontend | healthy | src/app/admin/(protected)/athle/page.tsx |
/admin/(protected)/matchs |
frontend | healthy | src/app/admin/(protected)/matchs/page.tsx |
/(public) |
frontend | healthy | src/app/(public)/page.tsx |
/(public)/carte |
frontend | healthy | src/app/(public)/carte/page.tsx |
/(public)/live |
frontend | healthy | src/app/(public)/live/page.tsx |
/(public)/galerie |
frontend | healthy | src/app/(public)/galerie/page.tsx |
/(public)/sante |
frontend | healthy | src/app/(public)/sante/page.tsx |
/(public)/sante/[slug] |
frontend | healthy | src/app/(public)/sante/[slug]/page.tsx |
/(public)/sante/[slug]/quiz |
frontend | healthy | src/app/(public)/sante/[slug]/quiz/page.tsx |
/(public)/sponsors |
frontend | healthy | src/app/(public)/sponsors/page.tsx |
/(public)/sondage |
frontend | healthy | src/app/(public)/sondage/page.tsx |
/(public)/food |
frontend | healthy | src/app/(public)/food/page.tsx |
/(public)/planning |
frontend | healthy | src/app/(public)/planning/page.tsx |
/(public)/tournoi |
frontend | healthy | src/app/(public)/tournoi/page.tsx |
/(public)/tournoi/match/[id] |
frontend | healthy | src/app/(public)/tournoi/match/[id]/page.tsx |
/(public)/tournoi/foot |
frontend | healthy | src/app/(public)/tournoi/foot/page.tsx |
/(public)/tournoi/athle |
frontend | healthy | src/app/(public)/tournoi/athle/page.tsx |
/(public)/tournoi/equipe/[id] |
frontend | healthy | src/app/(public)/tournoi/equipe/[id]/page.tsx |
/(public)/tournoi/volley |
frontend | healthy | src/app/(public)/tournoi/volley/page.tsx |
/ |
frontend | healthy | src/lib/auth/cookies.ts |
| Label | Layer | Status | Path |
|---|---|---|---|
BottomNav |
frontend | healthy | src/components/public/BottomNav.tsx |
ComingSoon |
frontend | healthy | src/components/public/ComingSoon.tsx |
MatchCard |
frontend | healthy | src/components/public/MatchCard.tsx |
BuccoQuizForm |
frontend | healthy | src/components/public/BuccoQuizForm.tsx |
LiveVideo |
frontend | healthy | src/components/public/LiveVideo.tsx |
EcransTestForm |
frontend | healthy | src/components/public/EcransTestForm.tsx |
LiveScore |
frontend | healthy | src/components/public/LiveScore.tsx |
Lightbox |
frontend | healthy | src/components/public/Lightbox.tsx |
RealtimeRefresh |
frontend | healthy | src/components/public/RealtimeRefresh.tsx |
SiteMap |
frontend | healthy | src/components/public/SiteMap.tsx |
LiveStreamBanner |
frontend | healthy | src/components/public/LiveStreamBanner.tsx |
RootLayout |
frontend | healthy | src/app/layout.tsx |
AdminNav |
frontend | healthy | src/app/admin/AdminNav.tsx |
PinForm |
frontend | healthy | src/app/admin/login/PinForm.tsx |
AdminStub |
frontend | healthy | src/app/admin/(protected)/_AdminStub.tsx |
AdminLoading |
frontend | healthy | src/app/admin/(protected)/loading.tsx |
LiveLinksForm |
frontend | healthy | src/app/admin/(protected)/live/LiveLinksForm.tsx |
TeamsManager |
frontend | healthy | src/app/admin/(protected)/equipes/TeamsManager.tsx |
AdminAthlePage |
frontend | healthy | src/app/admin/(protected)/athle/page.tsx |
MatchManager |
frontend | healthy | src/app/admin/(protected)/matchs/MatchManager.tsx |
HomePage |
frontend | healthy | src/app/(public)/page.tsx |
PublicLayout |
frontend | healthy | src/app/(public)/layout.tsx |
SondagePage |
frontend | healthy | src/app/(public)/sondage/page.tsx |
FoodPage |
frontend | healthy | src/app/(public)/food/page.tsx |
PlanningPage |
frontend | healthy | src/app/(public)/planning/page.tsx |
| Label | Layer | Status | Path |
|---|---|---|---|
staff |
data | healthy | supabase/apply-me.sql |
staff_sessions |
data | healthy | supabase/apply-me.sql |
staff_login_attempts |
data | healthy | supabase/apply-me.sql |
teams |
data | healthy | supabase/apply-me.sql |
pools |
data | healthy | supabase/apply-me.sql |
pool_teams |
data | healthy | supabase/apply-me.sql |
fields |
data | healthy | supabase/apply-me.sql |
matches |
data | healthy | supabase/apply-me.sql |
athletics_events |
data | healthy | supabase/apply-me.sql |
athletes |
data | healthy | supabase/apply-me.sql |
event_results |
data | healthy | supabase/apply-me.sql |
schedule_items |
data | healthy | supabase/apply-me.sql |
health_stands |
data | healthy | supabase/apply-me.sql |
health_speakers |
data | healthy | supabase/apply-me.sql |
health_documents |
data | healthy | supabase/apply-me.sql |
map_pois |
data | healthy | supabase/apply-me.sql |
foodtruck_items |
data | healthy | supabase/apply-me.sql |
photos |
data | healthy | supabase/apply-me.sql |
sponsors |
data | healthy | supabase/apply-me.sql |
survey_responses |
data | healthy | supabase/apply-me.sql |
app_settings |
data | healthy | supabase/apply-me.sql |
quiz_responses |
data | healthy | supabase/2026-06-13-quiz-village.sql |
form_responses |
data | healthy | supabase/2026-06-13-form-responses.sql |
| Label | Layer | Status | Path |
|---|---|---|---|
repobility-clone-34u_6wvt |
software | healthy | /tmp/repobility-clone-34u_6wvt |
| Label | Layer | Status | Path |
|---|---|---|---|
postgres |
data | healthy | src/app/admin/(protected)/sondage/page.tsx |
| Label | Layer | Status | Path |
|---|---|---|---|
0001_init.sql |
data | healthy | supabase/migrations/0001_init.sql |
This page is publicly accessible at:
https://repobility.com/scan/2d3e4a6f-f49f-47ca-85f3-9ac035611eb8/
To check status programmatically (no auth required):
curl -s https://repobility.com/api/v1/public/scan/2d3e4a6f-f49f-47ca-85f3-9ac035611eb8/
Important — please don't re-submit the same URL repeatedly. The submission endpoint is idempotent: re-submitting the same git URL returns this same scan_token, not a new one. To re-scan this repo, sign up free and use the dashboard.